C19H15N3O4S — CID 102369357
(1R,3aS,9bS)-1'-methyl-3a-nitro-3-sulfanylidenespiro[4,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2'-one (PubChem CID 102369357) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is (1R,3aS,9bS)-1'-methyl-3a-nitro-3-sulfanylidenespiro[4,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2'-one.
| Compound Name | (1R,3aS,9bS)-1'-methyl-3a-nitro-3-sulfanylidenespiro[4,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102369357 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (1R,3aS,9bS)-1'-methyl-3a-nitro-3-sulfanylidenespiro[4,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@]2(NC(=S)[C@@]3([N+](=O)[O-])COc4ccccc4[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C19H15N3O4S/c1-21-13-8-4-3-7-12(13)19(17(21)23)15-11-6-2-5-9-14(11)26-10-18(15,22(24)25)16(27)20-19/h2-9,15H,10H2,1H3,(H,20,27)/t15-,18-,19+/m1/s1 |
| InChIKey | ZCPDCJHDCFMLQG-LZQZEXGQSA-N |
| XLogP | 1.98 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|