C25H19BrN2O3 — CID 155937324
(1R,3S,3aS,9bS)-3-(4-bromophenyl)-1'-methylspiro[2,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione (PubChem CID 155937324) has the molecular formula C25H19BrN2O3 and a molecular weight of 475.34 g/mol. Its IUPAC name is (1R,3S,3aS,9bS)-3-(4-bromophenyl)-1'-methylspiro[2,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione.
| Compound Name | (1R,3S,3aS,9bS)-3-(4-bromophenyl)-1'-methylspiro[2,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 155937324 |
| Molecular Formula | C25H19BrN2O3 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | (1R,3S,3aS,9bS)-3-(4-bromophenyl)-1'-methylspiro[2,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione |
| SMILES | CN1C(=O)[C@]2(N[C@H](c3ccc(Br)cc3)[C@H]3C(=O)Oc4ccccc4[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C25H19BrN2O3/c1-28-18-8-4-3-7-17(18)25(24(28)30)21-16-6-2-5-9-19(16)31-23(29)20(21)22(27-25)14-10-12-15(26)13-11-14/h2-13,20-22,27H,1H3/t20-,21+,22+,25-/m0/s1 |
| InChIKey | JYSXJYJMASHPNJ-OUMCCJGNSA-N |
| XLogP | 4.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|