C30H21BrN2O3 — CID 155937318
(1R,3S,3aS,9bS)-3-(4-bromophenyl)-1'-phenylspiro[2,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione (PubChem CID 155937318) has the molecular formula C30H21BrN2O3 and a molecular weight of 537.41 g/mol. Its IUPAC name is (1R,3S,3aS,9bS)-3-(4-bromophenyl)-1'-phenylspiro[2,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione.
| Compound Name | (1R,3S,3aS,9bS)-3-(4-bromophenyl)-1'-phenylspiro[2,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 155937318 |
| Molecular Formula | C30H21BrN2O3 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | (1R,3S,3aS,9bS)-3-(4-bromophenyl)-1'-phenylspiro[2,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione |
| SMILES | O=C1Oc2ccccc2[C@@H]2[C@H]1[C@@H](c1ccc(Br)cc1)N[C@]21C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C30H21BrN2O3/c31-19-16-14-18(15-17-19)27-25-26(21-10-4-7-13-24(21)36-28(25)34)30(32-27)22-11-5-6-12-23(22)33(29(30)35)20-8-2-1-3-9-20/h1-17,25-27,32H/t25-,26+,27+,30-/m0/s1 |
| InChIKey | PURCKRNBZSPTAR-TXQUNOLYSA-N |
| XLogP | 5.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|