C25H18N2O4S — CID 146161901
(1R,3aR,9bS)-8-methoxy-1'-phenyl-3-sulfanylidenespiro[3a,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione (PubChem CID 146161901) has the molecular formula C25H18N2O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is (1R,3aR,9bS)-8-methoxy-1'-phenyl-3-sulfanylidenespiro[3a,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione.
| Compound Name | (1R,3aR,9bS)-8-methoxy-1'-phenyl-3-sulfanylidenespiro[3a,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 146161901 |
| Molecular Formula | C25H18N2O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (1R,3aR,9bS)-8-methoxy-1'-phenyl-3-sulfanylidenespiro[3a,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2',4-dione |
| SMILES | COc1ccc2c(c1)[C@@H]1[C@H](C(=O)O2)C(=S)N[C@]12C(=O)N(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C25H18N2O4S/c1-30-15-11-12-19-16(13-15)21-20(23(28)31-19)22(32)26-25(21)17-9-5-6-10-18(17)27(24(25)29)14-7-3-2-4-8-14/h2-13,20-21H,1H3,(H,26,32)/t20-,21+,25-/m0/s1 |
| InChIKey | RCBDGZLHLJSKHP-BKSPAHHJSA-N |
| XLogP | 3.82 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|