C20H17N3O5S — CID 102369361
(1R,3aS,9bS)-8-methoxy-1'-methyl-3a-nitro-3-sulfanylidenespiro[4,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2'-one (PubChem CID 102369361) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is (1R,3aS,9bS)-8-methoxy-1'-methyl-3a-nitro-3-sulfanylidenespiro[4,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2'-one.
| Compound Name | (1R,3aS,9bS)-8-methoxy-1'-methyl-3a-nitro-3-sulfanylidenespiro[4,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102369361 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (1R,3aS,9bS)-8-methoxy-1'-methyl-3a-nitro-3-sulfanylidenespiro[4,9b-dihydro-2H-chromeno[3,4-c]pyrrole-1,3'-indole]-2'-one |
| SMILES | COc1ccc2c(c1)[C@@H]1[C@]([N+](=O)[O-])(CO2)C(=S)N[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C20H17N3O5S/c1-22-14-6-4-3-5-13(14)20(18(22)24)16-12-9-11(27-2)7-8-15(12)28-10-19(16,23(25)26)17(29)21-20/h3-9,16H,10H2,1-2H3,(H,21,29)/t16-,19-,20+/m1/s1 |
| InChIKey | QAQKDLNFTVYSSK-AHRSYUTCSA-N |
| XLogP | 1.99 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|