C23H17N3O5 — CID 102497486
(2S,3S)-1'-methyl-2-(4-nitrobenzoyl)spiro[2,4-dihydro-1,4-benzoxazine-3,3'-indole]-2'-one (PubChem CID 102497486) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is (2S,3S)-1'-methyl-2-(4-nitrobenzoyl)spiro[2,4-dihydro-1,4-benzoxazine-3,3'-indole]-2'-one.
| Compound Name | (2S,3S)-1'-methyl-2-(4-nitrobenzoyl)spiro[2,4-dihydro-1,4-benzoxazine-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102497486 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (2S,3S)-1'-methyl-2-(4-nitrobenzoyl)spiro[2,4-dihydro-1,4-benzoxazine-3,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@]2(Nc3ccccc3O[C@@H]2C(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C23H17N3O5/c1-25-18-8-4-2-6-16(18)23(22(25)28)21(31-19-9-5-3-7-17(19)24-23)20(27)14-10-12-15(13-11-14)26(29)30/h2-13,21,24H,1H3/t21-,23+/m1/s1 |
| InChIKey | QMZCGFAOUXZSEA-GGAORHGYSA-N |
| XLogP | 3.52 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|