C20H16F3N3O4 — CID 122379905
(3R,3'S,4'R,5'S)-1-methyl-4'-(4-nitrophenyl)-2-oxo-5'-(trifluoromethyl)spiro[indole-3,2'-pyrrolidine]-3'-carbaldehyde (PubChem CID 122379905) has the molecular formula C20H16F3N3O4 and a molecular weight of 419.36 g/mol. Its IUPAC name is (3R,3'S,4'R,5'S)-1-methyl-4'-(4-nitrophenyl)-2-oxo-5'-(trifluoromethyl)spiro[indole-3,2'-pyrrolidine]-3'-carbaldehyde.
| Compound Name | (3R,3'S,4'R,5'S)-1-methyl-4'-(4-nitrophenyl)-2-oxo-5'-(trifluoromethyl)spiro[indole-3,2'-pyrrolidine]-3'-carbaldehyde |
|---|---|
| PubChem CID | 122379905 |
| Molecular Formula | C20H16F3N3O4 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (3R,3'S,4'R,5'S)-1-methyl-4'-(4-nitrophenyl)-2-oxo-5'-(trifluoromethyl)spiro[indole-3,2'-pyrrolidine]-3'-carbaldehyde |
| SMILES | CN1C(=O)[C@]2(N[C@H](C(F)(F)F)[C@@H](c3ccc([N+](=O)[O-])cc3)[C@@H]2C=O)c2ccccc21 |
| InChI | InChI=1S/C20H16F3N3O4/c1-25-15-5-3-2-4-13(15)19(18(25)28)14(10-27)16(17(24-19)20(21,22)23)11-6-8-12(9-7-11)26(29)30/h2-10,14,16-17,24H,1H3/t14-,16-,17-,19-/m0/s1 |
| InChIKey | OYEFZIRJTGXNJA-XPYUAMARSA-N |
| XLogP | 2.90 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|