C16H16N2O2 — CID 53253608
9,9,10-trimethyl-2-nitroacridine (PubChem CID 53253608) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 9,9,10-trimethyl-2-nitroacridine.
| Compound Name | 9,9,10-trimethyl-2-nitroacridine |
|---|---|
| PubChem CID | 53253608 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 9,9,10-trimethyl-2-nitroacridine |
| SMILES | CN1c2ccccc2C(C)(C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H16N2O2/c1-16(2)12-6-4-5-7-14(12)17(3)15-9-8-11(18(19)20)10-13(15)16/h4-10H,1-3H3 |
| InChIKey | YUGDGZXPHBBFKW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|