C18H17N3O3 — CID 6175041
(2Z)-1-pyridin-3-yl-2-(1,3,3-trimethyl-5-nitroindol-2-ylidene)ethanone (PubChem CID 6175041) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2Z)-1-pyridin-3-yl-2-(1,3,3-trimethyl-5-nitroindol-2-ylidene)ethanone.
| Compound Name | (2Z)-1-pyridin-3-yl-2-(1,3,3-trimethyl-5-nitroindol-2-ylidene)ethanone |
|---|---|
| PubChem CID | 6175041 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2Z)-1-pyridin-3-yl-2-(1,3,3-trimethyl-5-nitroindol-2-ylidene)ethanone |
| SMILES | CN1/C(=C\C(=O)c2cccnc2)C(C)(C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H17N3O3/c1-18(2)14-9-13(21(23)24)6-7-15(14)20(3)17(18)10-16(22)12-5-4-8-19-11-12/h4-11H,1-3H3/b17-10- |
| InChIKey | SIBAQRVQCJYNHP-YVLHZVERSA-N |
| XLogP | 3.48 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|