C17H13FN2O5 — CID 2949052
3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxy-1-methyl-5-nitroindol-2-one (PubChem CID 2949052) has the molecular formula C17H13FN2O5 and a molecular weight of 344.30 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxy-1-methyl-5-nitroindol-2-one.
| Compound Name | 3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxy-1-methyl-5-nitroindol-2-one |
|---|---|
| PubChem CID | 2949052 |
| Molecular Formula | C17H13FN2O5 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxy-1-methyl-5-nitroindol-2-one |
| SMILES | CN1C(=O)C(O)(CC(=O)c2ccc(F)cc2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H13FN2O5/c1-19-14-7-6-12(20(24)25)8-13(14)17(23,16(19)22)9-15(21)10-2-4-11(18)5-3-10/h2-8,23H,9H2,1H3 |
| InChIKey | JYBAVVMAJUBJSJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|