C21H16FNO3 — CID 151072238
5-fluoro-3-hydroxy-1-methyl-3-(2-naphthalen-2-yl-2-oxoethyl)indol-2-one (PubChem CID 151072238) has the molecular formula C21H16FNO3 and a molecular weight of 349.36 g/mol. Its IUPAC name is 5-fluoro-3-hydroxy-1-methyl-3-(2-naphthalen-2-yl-2-oxoethyl)indol-2-one.
| Compound Name | 5-fluoro-3-hydroxy-1-methyl-3-(2-naphthalen-2-yl-2-oxoethyl)indol-2-one |
|---|---|
| PubChem CID | 151072238 |
| Molecular Formula | C21H16FNO3 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5-fluoro-3-hydroxy-1-methyl-3-(2-naphthalen-2-yl-2-oxoethyl)indol-2-one |
| SMILES | CN1C(=O)C(O)(CC(=O)c2ccc3ccccc3c2)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H16FNO3/c1-23-18-9-8-16(22)11-17(18)21(26,20(23)25)12-19(24)15-7-6-13-4-2-3-5-14(13)10-15/h2-11,26H,12H2,1H3 |
| InChIKey | MIJLRNCTMBAHNG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |