C18H15BrFNO3 — CID 17077572
5-bromo-1-ethyl-3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 17077572) has the molecular formula C18H15BrFNO3 and a molecular weight of 392.22 g/mol. Its IUPAC name is 5-bromo-1-ethyl-3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
| Compound Name | 5-bromo-1-ethyl-3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 17077572 |
| Molecular Formula | C18H15BrFNO3 |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 5-bromo-1-ethyl-3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | CCN1C(=O)C(O)(CC(=O)c2ccc(F)cc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C18H15BrFNO3/c1-2-21-15-8-5-12(19)9-14(15)18(24,17(21)23)10-16(22)11-3-6-13(20)7-4-11/h3-9,24H,2,10H2,1H3 |
| InChIKey | RENPTZKHZFCESM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |