C16H11FN2O5 — CID 92502316
(3R)-5-fluoro-3-hydroxy-3-[2-(4-nitrophenyl)-2-oxoethyl]-1H-indol-2-one (PubChem CID 92502316) has the molecular formula C16H11FN2O5 and a molecular weight of 330.27 g/mol. Its IUPAC name is (3R)-5-fluoro-3-hydroxy-3-[2-(4-nitrophenyl)-2-oxoethyl]-1H-indol-2-one.
| Compound Name | (3R)-5-fluoro-3-hydroxy-3-[2-(4-nitrophenyl)-2-oxoethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 92502316 |
| Molecular Formula | C16H11FN2O5 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (3R)-5-fluoro-3-hydroxy-3-[2-(4-nitrophenyl)-2-oxoethyl]-1H-indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)Nc2ccc(F)cc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H11FN2O5/c17-10-3-6-13-12(7-10)16(22,15(21)18-13)8-14(20)9-1-4-11(5-2-9)19(23)24/h1-7,22H,8H2,(H,18,21)/t16-/m1/s1 |
| InChIKey | KTHMAQRPIHGIOP-MRXNPFEDSA-N |
| XLogP | 2.15 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|