C17H15NO4 — CID 72734849
3,5-dihydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-1H-indol-2-one (PubChem CID 72734849) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3,5-dihydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-1H-indol-2-one.
| Compound Name | 3,5-dihydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 72734849 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3,5-dihydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-1H-indol-2-one |
| SMILES | Cc1ccc(C(=O)CC2(O)C(=O)Nc3ccc(O)cc32)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-10-2-4-11(5-3-10)15(20)9-17(22)13-8-12(19)6-7-14(13)18-16(17)21/h2-8,19,22H,9H2,1H3,(H,18,21) |
| InChIKey | NIEKKNKFUUWNGG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|