C24H21NO3 — CID 1075623
(3S)-5-ethyl-3-hydroxy-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1H-indol-2-one (PubChem CID 1075623) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (3S)-5-ethyl-3-hydroxy-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1H-indol-2-one.
| Compound Name | (3S)-5-ethyl-3-hydroxy-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 1075623 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (3S)-5-ethyl-3-hydroxy-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1H-indol-2-one |
| SMILES | CCc1ccc2c(c1)[C@@](O)(CC(=O)c1ccc(-c3ccccc3)cc1)C(=O)N2 |
| InChI | InChI=1S/C24H21NO3/c1-2-16-8-13-21-20(14-16)24(28,23(27)25-21)15-22(26)19-11-9-18(10-12-19)17-6-4-3-5-7-17/h3-14,28H,2,15H2,1H3,(H,25,27)/t24-/m0/s1 |
| InChIKey | BJXOBCWSRQOCNX-DEOSSOPVSA-N |
| XLogP | 4.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |