C18H15BrN2O5 — CID 17138995
5-bromo-3-hydroxy-1-methyl-3-[2-(4-methyl-3-nitrophenyl)-2-oxoethyl]indol-2-one (PubChem CID 17138995) has the molecular formula C18H15BrN2O5 and a molecular weight of 419.23 g/mol. Its IUPAC name is 5-bromo-3-hydroxy-1-methyl-3-[2-(4-methyl-3-nitrophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | 5-bromo-3-hydroxy-1-methyl-3-[2-(4-methyl-3-nitrophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 17138995 |
| Molecular Formula | C18H15BrN2O5 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 5-bromo-3-hydroxy-1-methyl-3-[2-(4-methyl-3-nitrophenyl)-2-oxoethyl]indol-2-one |
| SMILES | Cc1ccc(C(=O)CC2(O)C(=O)N(C)c3ccc(Br)cc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15BrN2O5/c1-10-3-4-11(7-15(10)21(25)26)16(22)9-18(24)13-8-12(19)5-6-14(13)20(2)17(18)23/h3-8,24H,9H2,1-2H3 |
| InChIKey | SHGOMXJPGUKLFO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|