C25H21BrN2O5 — CID 40878286
(3R)-5-bromo-1-[(2,5-dimethylphenyl)methyl]-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]indol-2-one (PubChem CID 40878286) has the molecular formula C25H21BrN2O5 and a molecular weight of 509.36 g/mol. Its IUPAC name is (3R)-5-bromo-1-[(2,5-dimethylphenyl)methyl]-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-5-bromo-1-[(2,5-dimethylphenyl)methyl]-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 40878286 |
| Molecular Formula | C25H21BrN2O5 |
| Molecular Weight | 509.36 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | (3R)-5-bromo-1-[(2,5-dimethylphenyl)methyl]-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]indol-2-one |
| SMILES | Cc1ccc(C)c(CN2C(=O)[C@@](O)(CC(=O)c3cccc([N+](=O)[O-])c3)c3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C25H21BrN2O5/c1-15-6-7-16(2)18(10-15)14-27-22-9-8-19(26)12-21(22)25(31,24(27)30)13-23(29)17-4-3-5-20(11-17)28(32)33/h3-12,31H,13-14H2,1-2H3/t25-/m1/s1 |
| InChIKey | QLOLZUDTSVBBEW-RUZDIDTESA-N |
| XLogP | 4.98 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|