C20H19BrN2O5 — CID 27522855
(3R)-5-bromo-1-butyl-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]indol-2-one (PubChem CID 27522855) has the molecular formula C20H19BrN2O5 and a molecular weight of 447.29 g/mol. Its IUPAC name is (3R)-5-bromo-1-butyl-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-5-bromo-1-butyl-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 27522855 |
| Molecular Formula | C20H19BrN2O5 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (3R)-5-bromo-1-butyl-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]indol-2-one |
| SMILES | CCCCN1C(=O)[C@@](O)(CC(=O)c2cccc([N+](=O)[O-])c2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H19BrN2O5/c1-2-3-9-22-17-8-7-14(21)11-16(17)20(26,19(22)25)12-18(24)13-5-4-6-15(10-13)23(27)28/h4-8,10-11,26H,2-3,9,12H2,1H3/t20-/m1/s1 |
| InChIKey | ZSQUEJRZYQORSN-HXUWFJFHSA-N |
| XLogP | 3.96 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|