C24H19BrN2O5 — CID 27522889
(3R)-5-bromo-3-hydroxy-3-[2-(4-nitrophenyl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one (PubChem CID 27522889) has the molecular formula C24H19BrN2O5 and a molecular weight of 495.33 g/mol. Its IUPAC name is (3R)-5-bromo-3-hydroxy-3-[2-(4-nitrophenyl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one.
| Compound Name | (3R)-5-bromo-3-hydroxy-3-[2-(4-nitrophenyl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one |
|---|---|
| PubChem CID | 27522889 |
| Molecular Formula | C24H19BrN2O5 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | (3R)-5-bromo-3-hydroxy-3-[2-(4-nitrophenyl)-2-oxoethyl]-1-(2-phenylethyl)indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(CCc2ccccc2)c2ccc(Br)cc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H19BrN2O5/c25-18-8-11-21-20(14-18)24(30,15-22(28)17-6-9-19(10-7-17)27(31)32)23(29)26(21)13-12-16-4-2-1-3-5-16/h1-11,14,30H,12-13,15H2/t24-/m1/s1 |
| InChIKey | VWCWVBBTGWLLPT-XMMPIXPASA-N |
| XLogP | 4.41 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|