C25H22N2O5 — CID 3819208
3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1-(3-phenylpropyl)indol-2-one (PubChem CID 3819208) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1-(3-phenylpropyl)indol-2-one.
| Compound Name | 3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1-(3-phenylpropyl)indol-2-one |
|---|---|
| PubChem CID | 3819208 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1-(3-phenylpropyl)indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(CCCc2ccccc2)c2ccccc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N2O5/c28-23(19-11-6-12-20(16-19)27(31)32)17-25(30)21-13-4-5-14-22(21)26(24(25)29)15-7-10-18-8-2-1-3-9-18/h1-6,8-9,11-14,16,30H,7,10,15,17H2 |
| InChIKey | RWGRXYWDBFQQMU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|