C22H23N3O5 — CID 7357496
(3R)-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1-(piperidin-1-ylmethyl)indol-2-one (PubChem CID 7357496) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1-(piperidin-1-ylmethyl)indol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1-(piperidin-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 7357496 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (3R)-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1-(piperidin-1-ylmethyl)indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(CN2CCCCC2)c2ccccc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H23N3O5/c26-20(16-7-6-8-17(13-16)25(29)30)14-22(28)18-9-2-3-10-19(18)24(21(22)27)15-23-11-4-1-5-12-23/h2-3,6-10,13,28H,1,4-5,11-12,14-15H2/t22-/m1/s1 |
| InChIKey | SUBZYTKBROJBEU-JOCHJYFZSA-N |
| XLogP | 2.85 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|