C23H26N2O3 — CID 1425972
(3S)-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-1-(piperidin-1-ylmethyl)indol-2-one (PubChem CID 1425972) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-1-(piperidin-1-ylmethyl)indol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-1-(piperidin-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 1425972 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (3S)-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-1-(piperidin-1-ylmethyl)indol-2-one |
| SMILES | Cc1ccc(C(=O)C[C@@]2(O)C(=O)N(CN3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-17-9-11-18(12-10-17)21(26)15-23(28)19-7-3-4-8-20(19)25(22(23)27)16-24-13-5-2-6-14-24/h3-4,7-12,28H,2,5-6,13-16H2,1H3/t23-/m0/s1 |
| InChIKey | BELXIODBTBSMCW-QHCPKHFHSA-N |
| XLogP | 3.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |