C24H18Br2N2O6 — CID 17077866
5-bromo-1-[(4-bromophenyl)methyl]-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]indol-2-one (PubChem CID 17077866) has the molecular formula C24H18Br2N2O6 and a molecular weight of 590.22 g/mol. Its IUPAC name is 5-bromo-1-[(4-bromophenyl)methyl]-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | 5-bromo-1-[(4-bromophenyl)methyl]-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 17077866 |
| Molecular Formula | C24H18Br2N2O6 |
| Molecular Weight | 590.22 g/mol |
| Exact Mass | 587.95 |
| IUPAC Name | 5-bromo-1-[(4-bromophenyl)methyl]-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]indol-2-one |
| SMILES | COc1ccc(C(=O)CC2(O)C(=O)N(Cc3ccc(Br)cc3)c3ccc(Br)cc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18Br2N2O6/c1-34-22-9-4-15(10-20(22)28(32)33)21(29)12-24(31)18-11-17(26)7-8-19(18)27(23(24)30)13-14-2-5-16(25)6-3-14/h2-11,31H,12-13H2,1H3 |
| InChIKey | QRNLYPGUKHTFEH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.22 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|