C21H20N2O8 — CID 1341771
ethyl 2-[(3R)-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate (PubChem CID 1341771) has the molecular formula C21H20N2O8 and a molecular weight of 428.40 g/mol. Its IUPAC name is ethyl 2-[(3R)-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate.
| Compound Name | ethyl 2-[(3R)-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 1341771 |
| Molecular Formula | C21H20N2O8 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | ethyl 2-[(3R)-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)[C@@](O)(CC(=O)c2ccc(OC)c([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C21H20N2O8/c1-3-31-19(25)12-22-15-7-5-4-6-14(15)21(27,20(22)26)11-17(24)13-8-9-18(30-2)16(10-13)23(28)29/h4-10,27H,3,11-12H2,1-2H3/t21-/m1/s1 |
| InChIKey | SBQUAGKEHUHPNV-OAQYLSRUSA-N |
| XLogP | 1.97 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|