C19H18N2O5 — CID 1320412
ethyl 2-[(3R)-3-hydroxy-2-oxo-3-(2-oxo-2-pyridin-4-ylethyl)indol-1-yl]acetate (PubChem CID 1320412) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is ethyl 2-[(3R)-3-hydroxy-2-oxo-3-(2-oxo-2-pyridin-4-ylethyl)indol-1-yl]acetate.
| Compound Name | ethyl 2-[(3R)-3-hydroxy-2-oxo-3-(2-oxo-2-pyridin-4-ylethyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 1320412 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | ethyl 2-[(3R)-3-hydroxy-2-oxo-3-(2-oxo-2-pyridin-4-ylethyl)indol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)[C@@](O)(CC(=O)c2ccncc2)c2ccccc21 |
| InChI | InChI=1S/C19H18N2O5/c1-2-26-17(23)12-21-15-6-4-3-5-14(15)19(25,18(21)24)11-16(22)13-7-9-20-10-8-13/h3-10,25H,2,11-12H2,1H3/t19-/m1/s1 |
| InChIKey | QSPBCAPOKXOTHX-LJQANCHMSA-N |
| XLogP | 1.45 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |