C22H24N2O5 — CID 3147824
ethyl 2-[3-[2-[4-(dimethylamino)phenyl]-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetate (PubChem CID 3147824) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is ethyl 2-[3-[2-[4-(dimethylamino)phenyl]-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[2-[4-(dimethylamino)phenyl]-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 3147824 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | ethyl 2-[3-[2-[4-(dimethylamino)phenyl]-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(O)(CC(=O)c2ccc(N(C)C)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O5/c1-4-29-20(26)14-24-18-8-6-5-7-17(18)22(28,21(24)27)13-19(25)15-9-11-16(12-10-15)23(2)3/h5-12,28H,4,13-14H2,1-3H3 |
| InChIKey | LSPWEQBCWRDSGX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |