C26H26N2O3 — CID 2908247
3-[2-[4-(dimethylamino)phenyl]-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)indol-2-one (PubChem CID 2908247) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-[2-[4-(dimethylamino)phenyl]-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)indol-2-one.
| Compound Name | 3-[2-[4-(dimethylamino)phenyl]-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)indol-2-one |
|---|---|
| PubChem CID | 2908247 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[2-[4-(dimethylamino)phenyl]-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)indol-2-one |
| SMILES | CN(C)c1ccc(C(=O)CC2(O)C(=O)N(CCc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-27(2)21-14-12-20(13-15-21)24(29)18-26(31)22-10-6-7-11-23(22)28(25(26)30)17-16-19-8-4-3-5-9-19/h3-15,31H,16-18H2,1-2H3 |
| InChIKey | VQKGTTAEGJAZKK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |