C26H25NO4 — CID 2915280
3-[2-(4-ethoxyphenyl)-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)indol-2-one (PubChem CID 2915280) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-[2-(4-ethoxyphenyl)-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)indol-2-one.
| Compound Name | 3-[2-(4-ethoxyphenyl)-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)indol-2-one |
|---|---|
| PubChem CID | 2915280 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-[2-(4-ethoxyphenyl)-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)indol-2-one |
| SMILES | CCOc1ccc(C(=O)CC2(O)C(=O)N(CCc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H25NO4/c1-2-31-21-14-12-20(13-15-21)24(28)18-26(30)22-10-6-7-11-23(22)27(25(26)29)17-16-19-8-4-3-5-9-19/h3-15,30H,2,16-18H2,1H3 |
| InChIKey | VKPXFOJEQQUDEK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |