C20H18INO5 — CID 2930270
ethyl 2-[3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate (PubChem CID 2930270) has the molecular formula C20H18INO5 and a molecular weight of 479.27 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 2930270 |
| Molecular Formula | C20H18INO5 |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | ethyl 2-[3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(O)(CC(=O)c2ccc(I)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H18INO5/c1-2-27-18(24)12-22-16-6-4-3-5-15(16)20(26,19(22)25)11-17(23)13-7-9-14(21)10-8-13/h3-10,26H,2,11-12H2,1H3 |
| InChIKey | RGWFOMKPBBJTDE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|