C16H14BrNO3S — CID 7281230
(3R)-5-bromo-3-hydroxy-1-methyl-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]indol-2-one (PubChem CID 7281230) has the molecular formula C16H14BrNO3S and a molecular weight of 380.26 g/mol. Its IUPAC name is (3R)-5-bromo-3-hydroxy-1-methyl-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-5-bromo-3-hydroxy-1-methyl-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 7281230 |
| Molecular Formula | C16H14BrNO3S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | (3R)-5-bromo-3-hydroxy-1-methyl-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]indol-2-one |
| SMILES | Cc1ccc(C(=O)C[C@]2(O)C(=O)N(C)c3ccc(Br)cc32)s1 |
| InChI | InChI=1S/C16H14BrNO3S/c1-9-3-6-14(22-9)13(19)8-16(21)11-7-10(17)4-5-12(11)18(2)15(16)20/h3-7,21H,8H2,1-2H3/t16-/m1/s1 |
| InChIKey | BNWMEXMTEXVNQJ-MRXNPFEDSA-N |
| XLogP | 3.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |