C15H12BrNO3S — CID 1330612
(3R)-3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-methylindol-2-one (PubChem CID 1330612) has the molecular formula C15H12BrNO3S and a molecular weight of 366.24 g/mol. Its IUPAC name is (3R)-3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-methylindol-2-one.
| Compound Name | (3R)-3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-methylindol-2-one |
|---|---|
| PubChem CID | 1330612 |
| Molecular Formula | C15H12BrNO3S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | (3R)-3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-methylindol-2-one |
| SMILES | CN1C(=O)[C@@](O)(CC(=O)c2ccc(Br)s2)c2ccccc21 |
| InChI | InChI=1S/C15H12BrNO3S/c1-17-10-5-3-2-4-9(10)15(20,14(17)19)8-11(18)12-6-7-13(16)21-12/h2-7,20H,8H2,1H3/t15-/m1/s1 |
| InChIKey | BOAVWNOODJQXIG-OAHLLOKOSA-N |
| XLogP | 2.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |