C21H17NO3 — CID 798655
(3R)-3-hydroxy-1-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)indol-2-one (PubChem CID 798655) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)indol-2-one |
|---|---|
| PubChem CID | 798655 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (3R)-3-hydroxy-1-methyl-3-(2-naphthalen-1-yl-2-oxoethyl)indol-2-one |
| SMILES | CN1C(=O)[C@@](O)(CC(=O)c2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C21H17NO3/c1-22-18-12-5-4-11-17(18)21(25,20(22)24)13-19(23)16-10-6-8-14-7-2-3-9-15(14)16/h2-12,25H,13H2,1H3/t21-/m1/s1 |
| InChIKey | GLVCUQWRRXRKMN-OAQYLSRUSA-N |
| XLogP | 3.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |