C28H23NO4 — CID 17131923
3-hydroxy-3-(2-naphthalen-1-yl-2-oxoethyl)-1-(2-phenoxyethyl)indol-2-one (PubChem CID 17131923) has the molecular formula C28H23NO4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-hydroxy-3-(2-naphthalen-1-yl-2-oxoethyl)-1-(2-phenoxyethyl)indol-2-one.
| Compound Name | 3-hydroxy-3-(2-naphthalen-1-yl-2-oxoethyl)-1-(2-phenoxyethyl)indol-2-one |
|---|---|
| PubChem CID | 17131923 |
| Molecular Formula | C28H23NO4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-hydroxy-3-(2-naphthalen-1-yl-2-oxoethyl)-1-(2-phenoxyethyl)indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(CCOc2ccccc2)c2ccccc21)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H23NO4/c30-26(23-14-8-10-20-9-4-5-13-22(20)23)19-28(32)24-15-6-7-16-25(24)29(27(28)31)17-18-33-21-11-2-1-3-12-21/h1-16,32H,17-19H2 |
| InChIKey | STSZSFQEECFZEA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |