C25H22ClNO5 — CID 95244744
(3S)-1-[2-(4-chlorophenoxy)ethyl]-3-hydroxy-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one (PubChem CID 95244744) has the molecular formula C25H22ClNO5 and a molecular weight of 451.91 g/mol. Its IUPAC name is (3S)-1-[2-(4-chlorophenoxy)ethyl]-3-hydroxy-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3S)-1-[2-(4-chlorophenoxy)ethyl]-3-hydroxy-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 95244744 |
| Molecular Formula | C25H22ClNO5 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (3S)-1-[2-(4-chlorophenoxy)ethyl]-3-hydroxy-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one |
| SMILES | COc1ccccc1C(=O)C[C@@]1(O)C(=O)N(CCOc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H22ClNO5/c1-31-23-9-5-2-6-19(23)22(28)16-25(30)20-7-3-4-8-21(20)27(24(25)29)14-15-32-18-12-10-17(26)11-13-18/h2-13,30H,14-16H2,1H3/t25-/m0/s1 |
| InChIKey | IJASZPOTSQUGHL-VWLOTQADSA-N |
| XLogP | 4.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |