C24H20ClNO4 — CID 1075376
(3S)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one (PubChem CID 1075376) has the molecular formula C24H20ClNO4 and a molecular weight of 421.88 g/mol. Its IUPAC name is (3S)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3S)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 1075376 |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (3S)-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one |
| SMILES | COc1ccccc1C(=O)C[C@@]1(O)C(=O)N(Cc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H20ClNO4/c1-30-22-9-5-2-6-18(22)21(27)14-24(29)19-7-3-4-8-20(19)26(23(24)28)15-16-10-12-17(25)13-11-16/h2-13,29H,14-15H2,1H3/t24-/m0/s1 |
| InChIKey | GFCAKUNHCCNHJZ-DEOSSOPVSA-N |
| XLogP | 4.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |