C26H25NO6 — CID 95244773
(3R)-3-hydroxy-1-[2-(2-methoxyphenoxy)ethyl]-3-[2-(4-methoxyphenyl)-2-oxoethyl]indol-2-one (PubChem CID 95244773) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[2-(2-methoxyphenoxy)ethyl]-3-[2-(4-methoxyphenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[2-(2-methoxyphenoxy)ethyl]-3-[2-(4-methoxyphenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 95244773 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (3R)-3-hydroxy-1-[2-(2-methoxyphenoxy)ethyl]-3-[2-(4-methoxyphenyl)-2-oxoethyl]indol-2-one |
| SMILES | COc1ccc(C(=O)C[C@]2(O)C(=O)N(CCOc3ccccc3OC)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H25NO6/c1-31-19-13-11-18(12-14-19)22(28)17-26(30)20-7-3-4-8-21(20)27(25(26)29)15-16-33-24-10-6-5-9-23(24)32-2/h3-14,30H,15-17H2,1-2H3/t26-/m1/s1 |
| InChIKey | MLXIYRUCRGXVSH-AREMUKBSSA-N |
| XLogP | 3.59 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |