About 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide
4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide (PubChem CID 15945089) has the molecular formula C20H20N4O3
and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide.
Molecular Properties
| Compound Name | 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide |
| PubChem CID | 15945089 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide |
| SMILES | CN1/C(=C/C=NNC(=O)c2ccc([N+](=O)[O-])cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20N4O3/c1-20(2)16-6-4-5-7-17(16)23(3)18(20)12-13-21-22-19(25)14-8-10-15(11-9-14)24(26)27/h4-13H,1-3H3,(H,22,25)/b18-12+,21-13? |
| InChIKey | LZCHAVSEFVJHKB-DCADJGDDSA-N |
| XLogP | 3.62 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide?
The IUPAC name of 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide (CID 15945089) is 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide.
What is the SMILES notation for 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide?
The canonical SMILES for 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide is CN1/C(=C/C=NNC(=O)c2ccc([N+](=O)[O-])cc2)C(C)(C)c2ccccc21.
What is the InChIKey of 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide?
The InChIKey is LZCHAVSEFVJHKB-DCADJGDDSA-N. The full InChI is InChI=1S/C20H20N4O3/c1-20(2)16-6-4-5-7-17(16)23(3)18(20)12-13-21-22-19(25)14-8-10-15(11-9-14)24(26)27/h4-13H,1-3H3,(H,22,25)/b18-12+,21-13?.
What are the key properties of 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide?
4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide has a molecular weight of 364.41 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide is sourced from PubChem (CID 15945089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).