C20H19ClN3O2- — CID 6901436
2-chloro-5-[(2E)-2-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]benzoate (PubChem CID 6901436) has the molecular formula C20H19ClN3O2- and a molecular weight of 368.84 g/mol. Its IUPAC name is 2-chloro-5-[(2E)-2-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]benzoate.
| Compound Name | 2-chloro-5-[(2E)-2-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 6901436 |
| Molecular Formula | C20H19ClN3O2- |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-chloro-5-[(2E)-2-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]benzoate |
| SMILES | CN1/C(=C\C=N\Nc2ccc(Cl)c(C(=O)[O-])c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20ClN3O2/c1-20(2)15-6-4-5-7-17(15)24(3)18(20)10-11-22-23-13-8-9-16(21)14(12-13)19(25)26/h4-12,23H,1-3H3,(H,25,26)/p-1/b18-10-,22-11+ |
| InChIKey | IBWFAPNPUHXJAK-GAXJMJBXSA-M |
| XLogP | 3.41 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|