C21H23BrN4O — CID 6900084
2-(4-bromoanilino)-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]acetamide (PubChem CID 6900084) has the molecular formula C21H23BrN4O and a molecular weight of 427.35 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]acetamide.
| Compound Name | 2-(4-bromoanilino)-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]acetamide |
|---|---|
| PubChem CID | 6900084 |
| Molecular Formula | C21H23BrN4O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]acetamide |
| SMILES | CN1/C(=C\C=N\NC(=O)CNc2ccc(Br)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C21H23BrN4O/c1-21(2)17-6-4-5-7-18(17)26(3)19(21)12-13-24-25-20(27)14-23-16-10-8-15(22)9-11-16/h4-13,23H,14H2,1-3H3,(H,25,27)/b19-12-,24-13+ |
| InChIKey | XXQWJFAUUJESQD-BCFQCKSHSA-N |
| XLogP | 4.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|