C25H24N4 — CID 30223942
(2Z)-N-(4-phenyldiazenylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine (PubChem CID 30223942) has the molecular formula C25H24N4 and a molecular weight of 380.50 g/mol. Its IUPAC name is (2Z)-N-(4-phenyldiazenylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine.
| Compound Name | (2Z)-N-(4-phenyldiazenylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
|---|---|
| PubChem CID | 30223942 |
| Molecular Formula | C25H24N4 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (2Z)-N-(4-phenyldiazenylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
| SMILES | CN1/C(=C\C=N\c2ccc(/N=N/c3ccccc3)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H24N4/c1-25(2)22-11-7-8-12-23(22)29(3)24(25)17-18-26-19-13-15-21(16-14-19)28-27-20-9-5-4-6-10-20/h4-18H,1-3H3/b24-17-,26-18+,28-27+ |
| InChIKey | FWCWWVUIXUJDSI-IYSRQEJVSA-N |
| XLogP | 7.12 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|