C20H20F2N2S — CID 2376526
(2Z)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3,3-trimethylindol-2-ylidene)ethanimine (PubChem CID 2376526) has the molecular formula C20H20F2N2S and a molecular weight of 358.46 g/mol. Its IUPAC name is (2Z)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3,3-trimethylindol-2-ylidene)ethanimine.
| Compound Name | (2Z)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
|---|---|
| PubChem CID | 2376526 |
| Molecular Formula | C20H20F2N2S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2Z)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
| SMILES | CN1/C(=C\C=N\c2ccc(SC(F)F)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20F2N2S/c1-20(2)16-6-4-5-7-17(16)24(3)18(20)12-13-23-14-8-10-15(11-9-14)25-19(21)22/h4-13,19H,1-3H3/b18-12-,23-13+ |
| InChIKey | MRBUWVMEVPUVOR-WVVFEJFTSA-N |
| XLogP | 6.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|