C18H19N3 — CID 21179247
(2Z)-N-pyridin-4-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanimine (PubChem CID 21179247) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is (2Z)-N-pyridin-4-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanimine.
| Compound Name | (2Z)-N-pyridin-4-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
|---|---|
| PubChem CID | 21179247 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (2Z)-N-pyridin-4-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
| SMILES | CN1/C(=C\C=N\c2ccncc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C18H19N3/c1-18(2)15-6-4-5-7-16(15)21(3)17(18)10-13-20-14-8-11-19-12-9-14/h4-13H,1-3H3/b17-10-,20-13+ |
| InChIKey | AYBFJNSYPHAQQN-OGDOFCIQSA-N |
| XLogP | 4.10 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|