C16H17N3S — CID 21179241
(E,2Z)-N-(1,3-thiazol-2-yl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine (PubChem CID 21179241) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is (E,2Z)-N-(1,3-thiazol-2-yl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine.
| Compound Name | (E,2Z)-N-(1,3-thiazol-2-yl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
|---|---|
| PubChem CID | 21179241 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (E,2Z)-N-(1,3-thiazol-2-yl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
| SMILES | CN1/C(=C\C=N\c2nccs2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C16H17N3S/c1-16(2)12-6-4-5-7-13(12)19(3)14(16)8-9-17-15-18-10-11-20-15/h4-11H,1-3H3/b14-8-,17-9+ |
| InChIKey | USGLCUILOWDZIJ-LIFAMERMSA-N |
| XLogP | 4.16 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|