C21H22N3S+ — CID 177394036
(E,2E)-N-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine (PubChem CID 177394036) has the molecular formula C21H22N3S+ and a molecular weight of 348.50 g/mol. Its IUPAC name is (E,2E)-N-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine.
| Compound Name | (E,2E)-N-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
|---|---|
| PubChem CID | 177394036 |
| Molecular Formula | C21H22N3S+ |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (E,2E)-N-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
| SMILES | CN1/C(=C/C=N/c2sc3ccccc3[n+]2C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C21H22N3S/c1-21(2)15-9-5-6-10-16(15)23(3)19(21)13-14-22-20-24(4)17-11-7-8-12-18(17)25-20/h5-14H,1-4H3/q+1 |
| InChIKey | VHKQQIYHAUSGTM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 19.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|