C23H22N2 — CID 2830673
N-naphthalen-2-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanimine (PubChem CID 2830673) has the molecular formula C23H22N2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanimine.
| Compound Name | N-naphthalen-2-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
|---|---|
| PubChem CID | 2830673 |
| Molecular Formula | C23H22N2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-naphthalen-2-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
| SMILES | CN1C(=C/C=N/c2ccc3ccccc3c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H22N2/c1-23(2)20-10-6-7-11-21(20)25(3)22(23)14-15-24-19-13-12-17-8-4-5-9-18(17)16-19/h4-16H,1-3H3/b22-14?,24-15+ |
| InChIKey | HJJBIQNOJRERBX-BGBLFQTGSA-N |
| XLogP | 5.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|