C20H19N3O2 — CID 1205751
6-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]-3H-1,3-benzoxazol-2-one (PubChem CID 1205751) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 6-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 1205751 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 6-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]-3H-1,3-benzoxazol-2-one |
| SMILES | CN1C(=C/C=N/c2ccc3[nH]c(=O)oc3c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H19N3O2/c1-20(2)14-6-4-5-7-16(14)23(3)18(20)10-11-21-13-8-9-15-17(12-13)25-19(24)22-15/h4-12H,1-3H3,(H,22,24)/b18-10?,21-11+ |
| InChIKey | CZBTYXAUNVTUBK-FZCBZZDJSA-N |
| XLogP | 4.13 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|