C20H21IN2 — CID 4087183
N-(4-iodo-3-methylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine (PubChem CID 4087183) has the molecular formula C20H21IN2 and a molecular weight of 416.31 g/mol. Its IUPAC name is N-(4-iodo-3-methylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine.
| Compound Name | N-(4-iodo-3-methylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
|---|---|
| PubChem CID | 4087183 |
| Molecular Formula | C20H21IN2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-(4-iodo-3-methylphenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
| SMILES | Cc1cc(/N=C/C=C2N(C)c3ccccc3C2(C)C)ccc1I |
| InChI | InChI=1S/C20H21IN2/c1-14-13-15(9-10-17(14)21)22-12-11-19-20(2,3)16-7-5-6-8-18(16)23(19)4/h5-13H,1-4H3/b19-11?,22-12+ |
| InChIKey | JTJLIJSIVCDITR-XIAASDDCSA-N |
| XLogP | 5.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|