C19H17F3N2 — CID 2346200
(2E)-N-(2,3,4-trifluorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine (PubChem CID 2346200) has the molecular formula C19H17F3N2 and a molecular weight of 330.35 g/mol. Its IUPAC name is (2E)-N-(2,3,4-trifluorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine.
| Compound Name | (2E)-N-(2,3,4-trifluorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
|---|---|
| PubChem CID | 2346200 |
| Molecular Formula | C19H17F3N2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2E)-N-(2,3,4-trifluorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanimine |
| SMILES | CN1/C(=C/C=N/c2ccc(F)c(F)c2F)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H17F3N2/c1-19(2)12-6-4-5-7-15(12)24(3)16(19)10-11-23-14-9-8-13(20)17(21)18(14)22/h4-11H,1-3H3/b16-10+,23-11+ |
| InChIKey | GAOZDBAVQWGMEG-QUCSAUPBSA-N |
| XLogP | 5.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|