C15H18N4O2 — CID 129431621
N'-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]oxamide (PubChem CID 129431621) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is N'-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]oxamide.
| Compound Name | N'-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]oxamide |
|---|---|
| PubChem CID | 129431621 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N'-[[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]oxamide |
| SMILES | CN1/C(=C/C=NNC(=O)C(N)=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H18N4O2/c1-15(2)10-6-4-5-7-11(10)19(3)12(15)8-9-17-18-14(21)13(16)20/h4-9H,1-3H3,(H2,16,20)(H,18,21)/b12-8+,17-9? |
| InChIKey | BLGXWQAFSPKDJD-LZVGRGQCSA-N |
| XLogP | 0.89 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|