C40H44N6O3 — CID 172948088
benzohydrazide;(2Z)-2-(1,3,3-trimethylindol-2-ylidene)acetaldehyde;N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide (PubChem CID 172948088) has the molecular formula C40H44N6O3 and a molecular weight of 656.83 g/mol. Its IUPAC name is benzohydrazide;(2Z)-2-(1,3,3-trimethylindol-2-ylidene)acetaldehyde;N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide.
| Compound Name | benzohydrazide;(2Z)-2-(1,3,3-trimethylindol-2-ylidene)acetaldehyde;N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide |
|---|---|
| PubChem CID | 172948088 |
| Molecular Formula | C40H44N6O3 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.35 |
| IUPAC Name | benzohydrazide;(2Z)-2-(1,3,3-trimethylindol-2-ylidene)acetaldehyde;N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]benzamide |
| SMILES | CN1/C(=C\C=N\NC(=O)c2ccccc2)C(C)(C)c2ccccc21.CN1/C(=C\C=O)C(C)(C)c2ccccc21.NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O.C13H15NO.C7H8N2O/c1-20(2)16-11-7-8-12-17(16)23(3)18(20)13-14-21-22-19(24)15-9-5-4-6-10-15;1-13(2)10-6-4-5-7-11(10)14(3)12(13)8-9-15;8-9-7(10)6-4-2-1-3-5-6/h4-14H,1-3H3,(H,22,24);4-9H,1-3H3;1-5H,8H2,(H,9,10)/b18-13-,21-14+;12-8-; |
| InChIKey | ZGCWGLIAXHDUJD-LUQITHHUSA-N |
| XLogP | 6.50 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|